About 2-piperidin-1-ylethyl adamantane-2-carboxylate
2-piperidin-1-ylethyl adamantane-2-carboxylate (PubChem CID 59383787) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl adamantane-2-carboxylate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl adamantane-2-carboxylate |
| PubChem CID | 59383787 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-piperidin-1-ylethyl adamantane-2-carboxylate |
| SMILES | O=C(OCCN1CCCCC1)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H29NO2/c20-18(21-7-6-19-4-2-1-3-5-19)17-15-9-13-8-14(11-15)12-16(17)10-13/h13-17H,1-12H2 |
| InChIKey | XRFRSROBGAIKKM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-1-ylethyl adamantane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl adamantane-2-carboxylate?
The IUPAC name of 2-piperidin-1-ylethyl adamantane-2-carboxylate (CID 59383787) is 2-piperidin-1-ylethyl adamantane-2-carboxylate.
What is the SMILES notation for 2-piperidin-1-ylethyl adamantane-2-carboxylate?
The canonical SMILES for 2-piperidin-1-ylethyl adamantane-2-carboxylate is O=C(OCCN1CCCCC1)C1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-piperidin-1-ylethyl adamantane-2-carboxylate?
The InChIKey is XRFRSROBGAIKKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2/c20-18(21-7-6-19-4-2-1-3-5-19)17-15-9-13-8-14(11-15)12-16(17)10-13/h13-17H,1-12H2.
What are the key properties of 2-piperidin-1-ylethyl adamantane-2-carboxylate?
2-piperidin-1-ylethyl adamantane-2-carboxylate has a molecular weight of 291.44 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl adamantane-2-carboxylate is sourced from PubChem (CID 59383787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).