C14H14BrNO5S — CID 59390057
[(Z)-1-(4-bromo-3-phenylmethoxy-1,2-oxazol-5-yl)prop-1-enyl] methanesulfonate (PubChem CID 59390057) has the molecular formula C14H14BrNO5S and a molecular weight of 388.24 g/mol. Its IUPAC name is [(Z)-1-(4-bromo-3-phenylmethoxy-1,2-oxazol-5-yl)prop-1-enyl] methanesulfonate.
| Compound Name | [(Z)-1-(4-bromo-3-phenylmethoxy-1,2-oxazol-5-yl)prop-1-enyl] methanesulfonate |
|---|---|
| PubChem CID | 59390057 |
| Molecular Formula | C14H14BrNO5S |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | [(Z)-1-(4-bromo-3-phenylmethoxy-1,2-oxazol-5-yl)prop-1-enyl] methanesulfonate |
| SMILES | C/C=C(\OS(C)(=O)=O)c1onc(OCc2ccccc2)c1Br |
| InChI | InChI=1S/C14H14BrNO5S/c1-3-11(21-22(2,17)18)13-12(15)14(16-20-13)19-9-10-7-5-4-6-8-10/h3-8H,9H2,1-2H3/b11-3- |
| InChIKey | DLKKSBQDDYZLOW-JYOAFUTRSA-N |
| XLogP | 3.35 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|