C11H12FN4O2+ — CID 59400975
[(2R,5S)-4-fluoro-5-(6-methyl-7H-purin-9-ium-9-yl)-2,5-dihydrofuran-2-yl]methanol (PubChem CID 59400975) has the molecular formula C11H12FN4O2+ and a molecular weight of 251.24 g/mol. Its IUPAC name is [(2R,5S)-4-fluoro-5-(6-methyl-7H-purin-9-ium-9-yl)-2,5-dihydrofuran-2-yl]methanol.
| Compound Name | [(2R,5S)-4-fluoro-5-(6-methyl-7H-purin-9-ium-9-yl)-2,5-dihydrofuran-2-yl]methanol |
|---|---|
| PubChem CID | 59400975 |
| Molecular Formula | C11H12FN4O2+ |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [(2R,5S)-4-fluoro-5-(6-methyl-7H-purin-9-ium-9-yl)-2,5-dihydrofuran-2-yl]methanol |
| SMILES | Cc1ncnc2c1[nH]c[n+]2[C@H]1O[C@@H](CO)C=C1F |
| InChI | InChI=1S/C11H11FN4O2/c1-6-9-10(14-4-13-6)16(5-15-9)11-8(12)2-7(3-17)18-11/h2,4-5,7,11,17H,3H2,1H3/p+1/t7-,11+/m1/s1 |
| InChIKey | ZTFMNWXOFVEAIB-HQJQHLMTSA-O |
| XLogP | 0.30 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|