C30H50N2O7 — CID 59404383
[(2E,8Z)-6-ethenyl-11-prop-2-enoyloxyundeca-2,8-dienyl] 3-[3-[bis(2-hydroxyethyl)amino]propyl-(3-oxobutyl)amino]propanoate (PubChem CID 59404383) has the molecular formula C30H50N2O7 and a molecular weight of 550.74 g/mol. Its IUPAC name is [(2E,8Z)-6-ethenyl-11-prop-2-enoyloxyundeca-2,8-dienyl] 3-[3-[bis(2-hydroxyethyl)amino]propyl-(3-oxobutyl)amino]propanoate.
| Compound Name | [(2E,8Z)-6-ethenyl-11-prop-2-enoyloxyundeca-2,8-dienyl] 3-[3-[bis(2-hydroxyethyl)amino]propyl-(3-oxobutyl)amino]propanoate |
|---|---|
| PubChem CID | 59404383 |
| Molecular Formula | C30H50N2O7 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | [(2E,8Z)-6-ethenyl-11-prop-2-enoyloxyundeca-2,8-dienyl] 3-[3-[bis(2-hydroxyethyl)amino]propyl-(3-oxobutyl)amino]propanoate |
| SMILES | C=CC(=O)OCC/C=C\CC(C=C)CC/C=C/COC(=O)CCN(CCCN(CCO)CCO)CCC(C)=O |
| InChI | InChI=1S/C30H50N2O7/c1-4-28(13-8-6-10-25-38-29(36)5-2)14-9-7-11-26-39-30(37)16-20-31(19-15-27(3)35)17-12-18-32(21-23-33)22-24-34/h4-8,11,28,33-34H,1-2,9-10,12-26H2,3H3/b8-6-,11-7+ |
| InChIKey | BRHIMDZPMAAMQL-FAWHLJIPSA-N |
| XLogP | 3.08 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|