C10H9N5O3 — CID 59410535
4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine (PubChem CID 59410535) has the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. Its IUPAC name is 4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine.
| Compound Name | 4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine |
|---|---|
| PubChem CID | 59410535 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 4,4-dimethyl-8-nitrotetrazolo[5,1-c][1,4]benzoxazine |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2-n2nnnc21 |
| InChI | InChI=1S/C10H9N5O3/c1-10(2)9-11-12-13-14(9)7-5-6(15(16)17)3-4-8(7)18-10/h3-5H,1-2H3 |
| InChIKey | KGWXHBFMXRWWCA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|