C41H36O9 — CID 59422752
[6-(5-ethenoxy-5-oxopentoxy)naphthalen-2-yl] 6-(4-prop-2-enoyloxybenzoyl)oxy-7-propylnaphthalene-2-carboxylate (PubChem CID 59422752) has the molecular formula C41H36O9 and a molecular weight of 672.73 g/mol. Its IUPAC name is [6-(5-ethenoxy-5-oxopentoxy)naphthalen-2-yl] 6-(4-prop-2-enoyloxybenzoyl)oxy-7-propylnaphthalene-2-carboxylate.
| Compound Name | [6-(5-ethenoxy-5-oxopentoxy)naphthalen-2-yl] 6-(4-prop-2-enoyloxybenzoyl)oxy-7-propylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59422752 |
| Molecular Formula | C41H36O9 |
| Molecular Weight | 672.73 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | [6-(5-ethenoxy-5-oxopentoxy)naphthalen-2-yl] 6-(4-prop-2-enoyloxybenzoyl)oxy-7-propylnaphthalene-2-carboxylate |
| SMILES | C=COC(=O)CCCCOc1ccc2cc(OC(=O)c3ccc4cc(OC(=O)c5ccc(OC(=O)C=C)cc5)c(CCC)cc4c3)ccc2c1 |
| InChI | InChI=1S/C41H36O9/c1-4-9-31-22-33-23-32(12-11-30(33)26-37(31)50-40(44)27-13-17-34(18-14-27)48-38(42)5-2)41(45)49-36-20-16-28-24-35(19-15-29(28)25-36)47-21-8-7-10-39(43)46-6-3/h5-6,11-20,22-26H,2-4,7-10,21H2,1H3 |
| InChIKey | KWAVMYWKYRBCGO-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.73 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|