About [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate
[ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate (PubChem CID 59426935) has the molecular formula C15H22O3Si2
and a molecular weight of 306.51 g/mol. Its IUPAC name is [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate.
Molecular Properties
| Compound Name | [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate |
| PubChem CID | 59426935 |
| Molecular Formula | C15H22O3Si2 |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate |
| SMILES | C=C[Si](C)(C)OC(=O)c1ccccc1O[Si](C)(C)C=C |
| InChI | InChI=1S/C15H22O3Si2/c1-7-19(3,4)17-14-12-10-9-11-13(14)15(16)18-20(5,6)8-2/h7-12H,1-2H2,3-6H3 |
| InChIKey | KQDGRRGMXQHAHV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate?
The IUPAC name of [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate (CID 59426935) is [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate.
What is the SMILES notation for [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate?
The canonical SMILES for [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate is C=C[Si](C)(C)OC(=O)c1ccccc1O[Si](C)(C)C=C.
What is the InChIKey of [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate?
The InChIKey is KQDGRRGMXQHAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3Si2/c1-7-19(3,4)17-14-12-10-9-11-13(14)15(16)18-20(5,6)8-2/h7-12H,1-2H2,3-6H3.
What are the key properties of [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate?
[ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate has a molecular weight of 306.51 g/mol, XLogP of 4.08, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [ethenyl(dimethyl)silyl] 2-[ethenyl(dimethyl)silyl]oxybenzoate is sourced from PubChem (CID 59426935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).