C19H12F3N3O3S2 — CID 59432921
N-(1,3-thiazol-2-yl)-1-[2-(trifluoromethyl)benzoyl]indole-5-sulfonamide (PubChem CID 59432921) has the molecular formula C19H12F3N3O3S2 and a molecular weight of 451.45 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-1-[2-(trifluoromethyl)benzoyl]indole-5-sulfonamide.
| Compound Name | N-(1,3-thiazol-2-yl)-1-[2-(trifluoromethyl)benzoyl]indole-5-sulfonamide |
|---|---|
| PubChem CID | 59432921 |
| Molecular Formula | C19H12F3N3O3S2 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-1-[2-(trifluoromethyl)benzoyl]indole-5-sulfonamide |
| SMILES | O=C(c1ccccc1C(F)(F)F)n1ccc2cc(S(=O)(=O)Nc3nccs3)ccc21 |
| InChI | InChI=1S/C19H12F3N3O3S2/c20-19(21,22)15-4-2-1-3-14(15)17(26)25-9-7-12-11-13(5-6-16(12)25)30(27,28)24-18-23-8-10-29-18/h1-11H,(H,23,24) |
| InChIKey | HKDVGLGUGQGOBY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |