C23H33BrF4 — CID 59481091
1-bromo-2,2,3,3-tetrafluoro-4-[4-(4-methylcyclohexyl)-1-bicyclo[2.2.2]octanyl]bicyclo[2.2.2]octane (PubChem CID 59481091) has the molecular formula C23H33BrF4 and a molecular weight of 465.41 g/mol. Its IUPAC name is 1-bromo-2,2,3,3-tetrafluoro-4-[4-(4-methylcyclohexyl)-1-bicyclo[2.2.2]octanyl]bicyclo[2.2.2]octane.
| Compound Name | 1-bromo-2,2,3,3-tetrafluoro-4-[4-(4-methylcyclohexyl)-1-bicyclo[2.2.2]octanyl]bicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 59481091 |
| Molecular Formula | C23H33BrF4 |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 1-bromo-2,2,3,3-tetrafluoro-4-[4-(4-methylcyclohexyl)-1-bicyclo[2.2.2]octanyl]bicyclo[2.2.2]octane |
| SMILES | CC1CCC(C23CCC(C45CCC(Br)(CC4)C(F)(F)C5(F)F)(CC2)CC3)CC1 |
| InChI | InChI=1S/C23H33BrF4/c1-16-2-4-17(5-3-16)18-6-9-19(10-7-18,11-8-18)20-12-14-21(24,15-13-20)23(27,28)22(20,25)26/h16-17H,2-15H2,1H3 |
| InChIKey | RRVRXXNNZDYOQT-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|