C24H25BrF12 — CID 87615121
1-[3,5-bis(trifluoromethyl)-1-adamantyl]-3-bromo-5,7-bis(trifluoromethyl)adamantane (PubChem CID 87615121) has the molecular formula C24H25BrF12 and a molecular weight of 621.34 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)-1-adamantyl]-3-bromo-5,7-bis(trifluoromethyl)adamantane.
| Compound Name | 1-[3,5-bis(trifluoromethyl)-1-adamantyl]-3-bromo-5,7-bis(trifluoromethyl)adamantane |
|---|---|
| PubChem CID | 87615121 |
| Molecular Formula | C24H25BrF12 |
| Molecular Weight | 621.34 g/mol |
| Exact Mass | 620.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)-1-adamantyl]-3-bromo-5,7-bis(trifluoromethyl)adamantane |
| SMILES | FC(F)(F)C12CC3CC(C(F)(F)F)(C1)CC(C14CC5(Br)CC(C(F)(F)F)(CC(C(F)(F)F)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C24H25BrF12/c25-20-10-17(7-18(11-20,23(32,33)34)9-19(8-17,12-20)24(35,36)37)14-1-13-2-15(4-14,21(26,27)28)6-16(3-13,5-14)22(29,30)31/h13H,1-12H2 |
| InChIKey | QDIBWHYLSMABGY-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.34 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|