C21H31BrF4 — CID 59480681
1-bromo-2,2,3,3-tetrafluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane (PubChem CID 59480681) has the molecular formula C21H31BrF4 and a molecular weight of 439.38 g/mol. Its IUPAC name is 1-bromo-2,2,3,3-tetrafluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane.
| Compound Name | 1-bromo-2,2,3,3-tetrafluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 59480681 |
| Molecular Formula | C21H31BrF4 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1-bromo-2,2,3,3-tetrafluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane |
| SMILES | CC1CCC(C2CCC(C34CCC(Br)(CC3)C(F)(F)C4(F)F)CC2)CC1 |
| InChI | InChI=1S/C21H31BrF4/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)18-10-12-19(22,13-11-18)21(25,26)20(18,23)24/h14-17H,2-13H2,1H3 |
| InChIKey | UGXNEPISHUSYJP-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|