C6H12N8S2 — CID 59497835
[4-amino-5-(carbamimidoylsulfanylmethyl)-1,2,4-triazol-3-yl]methyl carbamimidothioate (PubChem CID 59497835) has the molecular formula C6H12N8S2 and a molecular weight of 260.35 g/mol. Its IUPAC name is [4-amino-5-(carbamimidoylsulfanylmethyl)-1,2,4-triazol-3-yl]methyl carbamimidothioate.
| Compound Name | [4-amino-5-(carbamimidoylsulfanylmethyl)-1,2,4-triazol-3-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 59497835 |
| Molecular Formula | C6H12N8S2 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | [4-amino-5-(carbamimidoylsulfanylmethyl)-1,2,4-triazol-3-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1nnc(CS/C(N)=N/[H])n1N |
| InChI | InChI=1S/C6H12N8S2/c7-5(8)15-1-3-12-13-4(14(3)11)2-16-6(9)10/h1-2,11H2,(H3,7,8)(H3,9,10) |
| InChIKey | JNQMIWZLODEENY-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|