C5H9N7S — CID 65212276
(4,6-diamino-1,3,5-triazin-2-yl)methyl carbamimidothioate (PubChem CID 65212276) has the molecular formula C5H9N7S and a molecular weight of 199.24 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl carbamimidothioate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl carbamimidothioate |
|---|---|
| PubChem CID | 65212276 |
| Molecular Formula | C5H9N7S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C5H9N7S/c6-3(7)13-1-2-10-4(8)12-5(9)11-2/h1H2,(H3,6,7)(H4,8,9,10,11,12) |
| InChIKey | NVYQDGFEMFHNPC-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|