C23H42O12 — CID 59502823
1-[2,3-bis(1-propan-2-yloxycarbonyloxypropan-2-yloxy)propoxy]ethyl propan-2-yl carbonate (PubChem CID 59502823) has the molecular formula C23H42O12 and a molecular weight of 510.58 g/mol. Its IUPAC name is 1-[2,3-bis(1-propan-2-yloxycarbonyloxypropan-2-yloxy)propoxy]ethyl propan-2-yl carbonate.
| Compound Name | 1-[2,3-bis(1-propan-2-yloxycarbonyloxypropan-2-yloxy)propoxy]ethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 59502823 |
| Molecular Formula | C23H42O12 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 1-[2,3-bis(1-propan-2-yloxycarbonyloxypropan-2-yloxy)propoxy]ethyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCC(C)OCC(COC(C)OC(=O)OC(C)C)OC(C)COC(=O)OC(C)C |
| InChI | InChI=1S/C23H42O12/c1-14(2)31-21(24)29-10-17(7)27-12-20(13-28-19(9)35-23(26)33-16(5)6)34-18(8)11-30-22(25)32-15(3)4/h14-20H,10-13H2,1-9H3 |
| InChIKey | WNBAVIAGUHPTEQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|