C10H11BO3RfS — CID 59515236
2-[(1-methyl-3H-2,1-benzoxaborol-7-yl)sulfanyl]acetic acid;rutherfordium (PubChem CID 59515236) has the molecular formula C10H11BO3RfS and a molecular weight of 489.07 g/mol. Its IUPAC name is 2-[(1-methyl-3H-2,1-benzoxaborol-7-yl)sulfanyl]acetic acid;rutherfordium.
| Compound Name | 2-[(1-methyl-3H-2,1-benzoxaborol-7-yl)sulfanyl]acetic acid;rutherfordium |
|---|---|
| PubChem CID | 59515236 |
| Molecular Formula | C10H11BO3RfS |
| Molecular Weight | 489.07 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 2-[(1-methyl-3H-2,1-benzoxaborol-7-yl)sulfanyl]acetic acid;rutherfordium |
| SMILES | CB1OCc2cccc(SCC(=O)O)c21.[Rf] |
| InChI | InChI=1S/C10H11BO3S.Rf/c1-11-10-7(5-14-11)3-2-4-8(10)15-6-9(12)13;/h2-4H,5-6H2,1H3,(H,12,13); |
| InChIKey | QNULXLRMQNWHBU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.07 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|