C38H38Br3N5O7 — CID 59516766
5,10,15-tribromo-18-(2-carboxyethyl)-20-[2-(1-carboxypropylamino)-2-oxoethyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-carboxylic acid (PubChem CID 59516766) has the molecular formula C38H38Br3N5O7 and a molecular weight of 916.46 g/mol. Its IUPAC name is 5,10,15-tribromo-18-(2-carboxyethyl)-20-[2-(1-carboxypropylamino)-2-oxoethyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-carboxylic acid.
| Compound Name | 5,10,15-tribromo-18-(2-carboxyethyl)-20-[2-(1-carboxypropylamino)-2-oxoethyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 59516766 |
| Molecular Formula | C38H38Br3N5O7 |
| Molecular Weight | 916.46 g/mol |
| Exact Mass | 913.03 |
| IUPAC Name | 5,10,15-tribromo-18-(2-carboxyethyl)-20-[2-(1-carboxypropylamino)-2-oxoethyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-carboxylic acid |
| SMILES | C=Cc1c(C)c2[nH]c1c(Br)c1[nH]c(c(Br)c3nc(c(CC(=O)NC(CC)C(=O)O)c4nc(c2Br)C(C)=C4CCC(=O)O)C(C(=O)O)=C3C)c(CC)c1C |
| InChI | InChI=1S/C38H38Br3N5O7/c1-8-18-14(4)29-26(39)31-16(6)20(11-12-24(48)49)33(43-31)21(13-23(47)42-22(10-3)37(50)51)34-25(38(52)53)17(7)32(44-34)28(41)36-19(9-2)15(5)30(46-36)27(40)35(18)45-29/h8,22,45-46H,1,9-13H2,2-7H3,(H,42,47)(H,48,49)(H,50,51)(H,52,53)/b29-26+,30-27+,31-26+,32-28+,33-21-,34-21-,35-27+,36-28+ |
| InChIKey | VVJHSEKQNVEHSB-LXZKXPMWSA-N |
| XLogP | 8.76 |
| TPSA | 198.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.46 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |