C36H38Br4N4O6 — CID 11586083
methyl 3-[5,10,15,20-tetrabromo-8,13-bis(1-hydroxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 11586083) has the molecular formula C36H38Br4N4O6 and a molecular weight of 942.34 g/mol. Its IUPAC name is methyl 3-[5,10,15,20-tetrabromo-8,13-bis(1-hydroxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[5,10,15,20-tetrabromo-8,13-bis(1-hydroxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 11586083 |
| Molecular Formula | C36H38Br4N4O6 |
| Molecular Weight | 942.34 g/mol |
| Exact Mass | 937.95 |
| IUPAC Name | methyl 3-[5,10,15,20-tetrabromo-8,13-bis(1-hydroxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)c2nc1c(Br)c1nc(c(Br)c3[nH]c(c(C)c3C(C)O)c(Br)c3[nH]c(c(C)c3C(C)O)c2Br)C(C)=C1CCC(=O)OC |
| InChI | InChI=1S/C36H38Br4N4O6/c1-13-19(9-11-21(47)49-7)33-28(40)34-20(10-12-22(48)50-8)14(2)30(42-34)26(38)35-24(18(6)46)16(4)32(44-35)27(39)36-23(17(5)45)15(3)31(43-36)25(37)29(13)41-33/h17-18,43-46H,9-12H2,1-8H3/b29-25+,30-26+,31-25+,32-27+,33-28+,34-28+,35-26+,36-27+ |
| InChIKey | PJVCQXBZJVLNFH-LYSDSXQQSA-N |
| XLogP | 9.86 |
| TPSA | 150.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.34 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |