C36H39Cl3N4O4 — CID 132850231
methyl 3-[5,15,20-trichloro-8,12-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 132850231) has the molecular formula C36H39Cl3N4O4 and a molecular weight of 698.09 g/mol. Its IUPAC name is methyl 3-[5,15,20-trichloro-8,12-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[5,15,20-trichloro-8,12-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 132850231 |
| Molecular Formula | C36H39Cl3N4O4 |
| Molecular Weight | 698.09 g/mol |
| Exact Mass | 696.20 |
| IUPAC Name | methyl 3-[5,15,20-trichloro-8,12-diethyl-18-(3-methoxy-3-oxopropyl)-3,7,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | CCc1c(C)c2[nH]c1cc1[nH]c(c(C)c1CC)c(Cl)c1nc(c(Cl)c3nc(c2Cl)C(C)=C3CCC(=O)OC)C(CCC(=O)OC)=C1C |
| InChI | InChI=1S/C36H39Cl3N4O4/c1-9-20-16(3)31-28(37)33-18(5)22(11-13-26(44)46-7)35(42-33)30(39)36-23(12-14-27(45)47-8)19(6)34(43-36)29(38)32-17(4)21(10-2)25(41-32)15-24(20)40-31/h15,40-41H,9-14H2,1-8H3/b24-15-,25-15-,31-28+,32-29+,33-28+,34-29+,35-30+,36-30+ |
| InChIKey | XJIKOPJRQWIGHA-HZZSBTSBSA-N |
| XLogP | 9.78 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.09 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |