C15H30O — CID 59531281
(2S,4R)-2-[(2S)-butan-2-yl]-1-deuterio-4-ethyl-3,5-dimethylheptan-1-one (PubChem CID 59531281) has the molecular formula C15H30O and a molecular weight of 227.41 g/mol. Its IUPAC name is (2S,4R)-2-[(2S)-butan-2-yl]-1-deuterio-4-ethyl-3,5-dimethylheptan-1-one.
| Compound Name | (2S,4R)-2-[(2S)-butan-2-yl]-1-deuterio-4-ethyl-3,5-dimethylheptan-1-one |
|---|---|
| PubChem CID | 59531281 |
| Molecular Formula | C15H30O |
| Molecular Weight | 227.41 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | (2S,4R)-2-[(2S)-butan-2-yl]-1-deuterio-4-ethyl-3,5-dimethylheptan-1-one |
| SMILES | [2H]C(=O)[C@H](C(C)[C@H](CC)C(C)CC)[C@@H](C)CC |
| InChI | InChI=1S/C15H30O/c1-7-11(4)14(9-3)13(6)15(10-16)12(5)8-2/h10-15H,7-9H2,1-6H3/t11?,12-,13?,14+,15-/m0/s1/i10D |
| InChIKey | XASKZWZILUENHX-HNNSNHNXSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|