C20H27FO3 — CID 59532598
[3-[(2-butyl-5-fluorophenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl acetate (PubChem CID 59532598) has the molecular formula C20H27FO3 and a molecular weight of 334.43 g/mol. Its IUPAC name is [3-[(2-butyl-5-fluorophenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl acetate.
| Compound Name | [3-[(2-butyl-5-fluorophenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59532598 |
| Molecular Formula | C20H27FO3 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [3-[(2-butyl-5-fluorophenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl acetate |
| SMILES | CCCCc1ccc(F)cc1CC1C2CCC(O2)C1COC(C)=O |
| InChI | InChI=1S/C20H27FO3/c1-3-4-5-14-6-7-16(21)10-15(14)11-17-18(12-23-13(2)22)20-9-8-19(17)24-20/h6-7,10,17-20H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | KGTQOLSGLNVMKO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |