C43H72N4O4S — CID 59539446
(E,12S)-12-acetamido-14-[(E,2R)-2-acetamido-13-[methyl-[(1E)-penta-1,4-dienyl]amino]-13-oxotridec-3-enyl]sulfanyl-N-methyl-N-[(1E)-penta-1,4-dienyl]tetradec-10-enamide (PubChem CID 59539446) has the molecular formula C43H72N4O4S and a molecular weight of 741.14 g/mol. Its IUPAC name is (E,12S)-12-acetamido-14-[(E,2R)-2-acetamido-13-[methyl-[(1E)-penta-1,4-dienyl]amino]-13-oxotridec-3-enyl]sulfanyl-N-methyl-N-[(1E)-penta-1,4-dienyl]tetradec-10-enamide.
| Compound Name | (E,12S)-12-acetamido-14-[(E,2R)-2-acetamido-13-[methyl-[(1E)-penta-1,4-dienyl]amino]-13-oxotridec-3-enyl]sulfanyl-N-methyl-N-[(1E)-penta-1,4-dienyl]tetradec-10-enamide |
|---|---|
| PubChem CID | 59539446 |
| Molecular Formula | C43H72N4O4S |
| Molecular Weight | 741.14 g/mol |
| Exact Mass | 740.53 |
| IUPAC Name | (E,12S)-12-acetamido-14-[(E,2R)-2-acetamido-13-[methyl-[(1E)-penta-1,4-dienyl]amino]-13-oxotridec-3-enyl]sulfanyl-N-methyl-N-[(1E)-penta-1,4-dienyl]tetradec-10-enamide |
| SMILES | C=CC/C=C/N(C)C(=O)CCCCCCCC/C=C/[C@H](CCSC[C@@H](/C=C/CCCCCCCCC(=O)N(C)/C=C/CC=C)NC(C)=O)NC(C)=O |
| InChI | InChI=1S/C43H72N4O4S/c1-7-9-27-34-46(5)42(50)31-25-21-17-13-11-15-19-23-29-40(44-38(3)48)33-36-52-37-41(45-39(4)49)30-24-20-16-12-14-18-22-26-32-43(51)47(6)35-28-10-8-2/h7-8,23-24,27-30,34-35,40-41H,1-2,9-22,25-26,31-33,36-37H2,3-6H3,(H,44,48)(H,45,49)/b29-23+,30-24+,34-27+,35-28+/t40-,41-/m1/s1 |
| InChIKey | IJYWKRVRBBBXDV-NZQWRCOSSA-N |
| XLogP | 9.57 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.14 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|