C30H52N2O6S2 — CID 25112295
(E,12R)-12-acetamido-13-[[(E,2R)-2-acetamido-12-carboxydodec-3-enyl]disulfanyl]tridec-10-enoic acid (PubChem CID 25112295) has the molecular formula C30H52N2O6S2 and a molecular weight of 600.89 g/mol. Its IUPAC name is (E,12R)-12-acetamido-13-[[(E,2R)-2-acetamido-12-carboxydodec-3-enyl]disulfanyl]tridec-10-enoic acid.
| Compound Name | (E,12R)-12-acetamido-13-[[(E,2R)-2-acetamido-12-carboxydodec-3-enyl]disulfanyl]tridec-10-enoic acid |
|---|---|
| PubChem CID | 25112295 |
| Molecular Formula | C30H52N2O6S2 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | (E,12R)-12-acetamido-13-[[(E,2R)-2-acetamido-12-carboxydodec-3-enyl]disulfanyl]tridec-10-enoic acid |
| SMILES | CC(=O)N[C@H](/C=C/CCCCCCCCC(=O)O)CSSC[C@@H](/C=C/CCCCCCCCC(=O)O)NC(C)=O |
| InChI | InChI=1S/C30H52N2O6S2/c1-25(33)31-27(19-15-11-7-3-5-9-13-17-21-29(35)36)23-39-40-24-28(32-26(2)34)20-16-12-8-4-6-10-14-18-22-30(37)38/h15-16,19-20,27-28H,3-14,17-18,21-24H2,1-2H3,(H,31,33)(H,32,34)(H,35,36)(H,37,38)/b19-15+,20-16+/t27-,28-/m1/s1 |
| InChIKey | GJAQHYPYVQCCHJ-KFLXHSPXSA-N |
| XLogP | 6.90 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|