C31H56N4O4S2 — CID 118123945
(E,12R)-12-acetamido-13-[[(E)-2-acetamido-13-(methylamino)-13-oxotridec-3-enyl]disulfanyl]tridec-10-enamide (PubChem CID 118123945) has the molecular formula C31H56N4O4S2 and a molecular weight of 612.95 g/mol. Its IUPAC name is (E,12R)-12-acetamido-13-[[(E)-2-acetamido-13-(methylamino)-13-oxotridec-3-enyl]disulfanyl]tridec-10-enamide.
| Compound Name | (E,12R)-12-acetamido-13-[[(E)-2-acetamido-13-(methylamino)-13-oxotridec-3-enyl]disulfanyl]tridec-10-enamide |
|---|---|
| PubChem CID | 118123945 |
| Molecular Formula | C31H56N4O4S2 |
| Molecular Weight | 612.95 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | (E,12R)-12-acetamido-13-[[(E)-2-acetamido-13-(methylamino)-13-oxotridec-3-enyl]disulfanyl]tridec-10-enamide |
| SMILES | CNC(=O)CCCCCCCC/C=C/C(CSSC[C@@H](/C=C/CCCCCCCCC(N)=O)NC(C)=O)NC(C)=O |
| InChI | InChI=1S/C31H56N4O4S2/c1-26(36)34-28(20-16-12-8-4-6-10-14-18-22-30(32)38)24-40-41-25-29(35-27(2)37)21-17-13-9-5-7-11-15-19-23-31(39)33-3/h16-17,20-21,28-29H,4-15,18-19,22-25H2,1-3H3,(H2,32,38)(H,33,39)(H,34,36)(H,35,37)/b20-16+,21-17+/t28-,29?/m1/s1 |
| InChIKey | DZOBNKXNPQWUDR-QKYNDLBASA-N |
| XLogP | 5.96 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.95 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|