C32H58N4O4S2 — CID 90896160
(12R)-12-acetamido-13-[[(2R)-2-acetamido-13-(methylamino)-13-oxotridec-3-enyl]disulfanyl]-N-methyltridec-10-enamide (PubChem CID 90896160) has the molecular formula C32H58N4O4S2 and a molecular weight of 626.97 g/mol. Its IUPAC name is (12R)-12-acetamido-13-[[(2R)-2-acetamido-13-(methylamino)-13-oxotridec-3-enyl]disulfanyl]-N-methyltridec-10-enamide.
| Compound Name | (12R)-12-acetamido-13-[[(2R)-2-acetamido-13-(methylamino)-13-oxotridec-3-enyl]disulfanyl]-N-methyltridec-10-enamide |
|---|---|
| PubChem CID | 90896160 |
| Molecular Formula | C32H58N4O4S2 |
| Molecular Weight | 626.97 g/mol |
| Exact Mass | 626.39 |
| IUPAC Name | (12R)-12-acetamido-13-[[(2R)-2-acetamido-13-(methylamino)-13-oxotridec-3-enyl]disulfanyl]-N-methyltridec-10-enamide |
| SMILES | CNC(=O)CCCCCCCCC=C[C@H](CSSC[C@@H](C=CCCCCCCCCC(=O)NC)NC(C)=O)NC(C)=O |
| InChI | InChI=1S/C32H58N4O4S2/c1-27(37)35-29(21-17-13-9-5-7-11-15-19-23-31(39)33-3)25-41-42-26-30(36-28(2)38)22-18-14-10-6-8-12-16-20-24-32(40)34-4/h17-18,21-22,29-30H,5-16,19-20,23-26H2,1-4H3,(H,33,39)(H,34,40)(H,35,37)(H,36,38)/t29-,30-/m1/s1 |
| InChIKey | ZVIGNQKHDHONEX-LOYHVIPDSA-N |
| XLogP | 6.22 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.97 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|