C17H31NO6S — CID 118121795
methyl (E)-12-acetamido-13-methylsulfonyloxytridec-10-enoate (PubChem CID 118121795) has the molecular formula C17H31NO6S and a molecular weight of 377.50 g/mol. Its IUPAC name is methyl (E)-12-acetamido-13-methylsulfonyloxytridec-10-enoate.
| Compound Name | methyl (E)-12-acetamido-13-methylsulfonyloxytridec-10-enoate |
|---|---|
| PubChem CID | 118121795 |
| Molecular Formula | C17H31NO6S |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | methyl (E)-12-acetamido-13-methylsulfonyloxytridec-10-enoate |
| SMILES | COC(=O)CCCCCCCC/C=C/C(COS(C)(=O)=O)NC(C)=O |
| InChI | InChI=1S/C17H31NO6S/c1-15(19)18-16(14-24-25(3,21)22)12-10-8-6-4-5-7-9-11-13-17(20)23-2/h10,12,16H,4-9,11,13-14H2,1-3H3,(H,18,19)/b12-10+ |
| InChIKey | LMVZQNGPLPICAH-ZRDIBKRKSA-N |
| XLogP | 2.32 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|