C12H17N2O3S2+ — CID 59539915
3-ethyl-2-propan-2-ylimino-3H-1,3-benzothiazol-3-ium-6-sulfonic acid (PubChem CID 59539915) has the molecular formula C12H17N2O3S2+ and a molecular weight of 301.41 g/mol. Its IUPAC name is 3-ethyl-2-propan-2-ylimino-3H-1,3-benzothiazol-3-ium-6-sulfonic acid.
| Compound Name | 3-ethyl-2-propan-2-ylimino-3H-1,3-benzothiazol-3-ium-6-sulfonic acid |
|---|---|
| PubChem CID | 59539915 |
| Molecular Formula | C12H17N2O3S2+ |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 3-ethyl-2-propan-2-ylimino-3H-1,3-benzothiazol-3-ium-6-sulfonic acid |
| SMILES | CC[NH+]1/C(=N/C(C)C)Sc2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C12H16N2O3S2/c1-4-14-10-6-5-9(19(15,16)17)7-11(10)18-12(14)13-8(2)3/h5-8H,4H2,1-3H3,(H,15,16,17)/p+1/b13-12- |
| InChIKey | JSTAEAIIUXZBMX-SEYXRHQNSA-O |
| XLogP | 1.34 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|