C25H38N2O6 — CID 59571337
(2S)-2-[[(3R)-3-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonyloxybutanoyl]amino]-3-methylbutanoic acid (PubChem CID 59571337) has the molecular formula C25H38N2O6 and a molecular weight of 462.59 g/mol. Its IUPAC name is (2S)-2-[[(3R)-3-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonyloxybutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(3R)-3-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonyloxybutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 59571337 |
| Molecular Formula | C25H38N2O6 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | (2S)-2-[[(3R)-3-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonyloxybutanoyl]amino]-3-methylbutanoic acid |
| SMILES | CCC1(c2cccc(OC(=O)O[C@H](C)CC(=O)N[C@H](C(=O)O)C(C)C)c2)CCCCN(C)C1 |
| InChI | InChI=1S/C25H38N2O6/c1-6-25(12-7-8-13-27(5)16-25)19-10-9-11-20(15-19)33-24(31)32-18(4)14-21(28)26-22(17(2)3)23(29)30/h9-11,15,17-18,22H,6-8,12-14,16H2,1-5H3,(H,26,28)(H,29,30)/t18-,22+,25?/m1/s1 |
| InChIKey | OYNLNFITFMYKAD-IIAXJLLOSA-N |
| XLogP | 3.97 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|