C28H36N2O5 — CID 59571323
(2S)-2-[[4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylbenzoyl]amino]-3-methylbutanoic acid (PubChem CID 59571323) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is (2S)-2-[[4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylbenzoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylbenzoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 59571323 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | (2S)-2-[[4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylbenzoyl]amino]-3-methylbutanoic acid |
| SMILES | CCC1(c2cccc(OC(=O)c3ccc(C(=O)N[C@H](C(=O)O)C(C)C)cc3)c2)CCCCN(C)C1 |
| InChI | InChI=1S/C28H36N2O5/c1-5-28(15-6-7-16-30(4)18-28)22-9-8-10-23(17-22)35-27(34)21-13-11-20(12-14-21)25(31)29-24(19(2)3)26(32)33/h8-14,17,19,24H,5-7,15-16,18H2,1-4H3,(H,29,31)(H,32,33)/t24-,28?/m0/s1 |
| InChIKey | JCDKRJQXJRPGHF-ZZDYIDRTSA-N |
| XLogP | 4.51 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|