C25H36N2O6 — CID 89014178
2-[[(Z)-4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]-3-methoxy-4-oxobut-2-enoyl]amino]-3-methylbutanoic acid (PubChem CID 89014178) has the molecular formula C25H36N2O6 and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-[[(Z)-4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]-3-methoxy-4-oxobut-2-enoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[(Z)-4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]-3-methoxy-4-oxobut-2-enoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 89014178 |
| Molecular Formula | C25H36N2O6 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 2-[[(Z)-4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]-3-methoxy-4-oxobut-2-enoyl]amino]-3-methylbutanoic acid |
| SMILES | CCC1(c2cccc(OC(=O)/C(=C/C(=O)NC(C(=O)O)C(C)C)OC)c2)CCCCN(C)C1 |
| InChI | InChI=1S/C25H36N2O6/c1-6-25(12-7-8-13-27(4)16-25)18-10-9-11-19(14-18)33-24(31)20(32-5)15-21(28)26-22(17(2)3)23(29)30/h9-11,14-15,17,22H,6-8,12-13,16H2,1-5H3,(H,26,28)(H,29,30)/b20-15- |
| InChIKey | ODLUUSJRFOXCIG-HKWRFOASSA-N |
| XLogP | 3.11 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|