C23H36N2O4 — CID 88985899
ethyl 2-[[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylamino]-3-methylbutanoate (PubChem CID 88985899) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is ethyl 2-[[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylamino]-3-methylbutanoate.
| Compound Name | ethyl 2-[[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 88985899 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | ethyl 2-[[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylamino]-3-methylbutanoate |
| SMILES | CCOC(=O)C(NC(=O)Oc1cccc(C2(CC)CCCCN(C)C2)c1)C(C)C |
| InChI | InChI=1S/C23H36N2O4/c1-6-23(13-8-9-14-25(5)16-23)18-11-10-12-19(15-18)29-22(27)24-20(17(3)4)21(26)28-7-2/h10-12,15,17,20H,6-9,13-14,16H2,1-5H3,(H,24,27) |
| InChIKey | MPHOAUPLXRXKKO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |