C27H44N4O4 — CID 88990334
[3-(3-ethyl-1-methylazepan-3-yl)phenyl] N-[5-[[(2S)-2-amino-3-methylbutanoyl]amino]-6-oxohexyl]carbamate (PubChem CID 88990334) has the molecular formula C27H44N4O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is [3-(3-ethyl-1-methylazepan-3-yl)phenyl] N-[5-[[(2S)-2-amino-3-methylbutanoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | [3-(3-ethyl-1-methylazepan-3-yl)phenyl] N-[5-[[(2S)-2-amino-3-methylbutanoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 88990334 |
| Molecular Formula | C27H44N4O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | [3-(3-ethyl-1-methylazepan-3-yl)phenyl] N-[5-[[(2S)-2-amino-3-methylbutanoyl]amino]-6-oxohexyl]carbamate |
| SMILES | CCC1(c2cccc(OC(=O)NCCCCC(C=O)NC(=O)[C@@H](N)C(C)C)c2)CCCCN(C)C1 |
| InChI | InChI=1S/C27H44N4O4/c1-5-27(14-7-9-16-31(4)19-27)21-11-10-13-23(17-21)35-26(34)29-15-8-6-12-22(18-32)30-25(33)24(28)20(2)3/h10-11,13,17-18,20,22,24H,5-9,12,14-16,19,28H2,1-4H3,(H,29,34)(H,30,33)/t22?,24-,27?/m0/s1 |
| InChIKey | AWDOVFWCLGCZQT-CRIAOJQNSA-N |
| XLogP | 3.38 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|