C30H40N2O5 — CID 89014136
2-[[(2R)-4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]-4-oxo-2-phenylbutanoyl]amino]-3-methylbutanoic acid (PubChem CID 89014136) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-[[(2R)-4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]-4-oxo-2-phenylbutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[(2R)-4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]-4-oxo-2-phenylbutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 89014136 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | 2-[[(2R)-4-[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]-4-oxo-2-phenylbutanoyl]amino]-3-methylbutanoic acid |
| SMILES | CCC1(c2cccc(OC(=O)C[C@@H](C(=O)NC(C(=O)O)C(C)C)c3ccccc3)c2)CCCCN(C)C1 |
| InChI | InChI=1S/C30H40N2O5/c1-5-30(16-9-10-17-32(4)20-30)23-14-11-15-24(18-23)37-26(33)19-25(22-12-7-6-8-13-22)28(34)31-27(21(2)3)29(35)36/h6-8,11-15,18,21,25,27H,5,9-10,16-17,19-20H2,1-4H3,(H,31,34)(H,35,36)/t25-,27?,30?/m1/s1 |
| InChIKey | FNJCHJSWHCCBEX-WUXOVTSDSA-N |
| XLogP | 4.75 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|