C16H20ClN3O3 — CID 59574350
2-[4-(2-adamantylamino)-5-chloro-6-oxopyridazin-1-yl]acetic acid (PubChem CID 59574350) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 2-[4-(2-adamantylamino)-5-chloro-6-oxopyridazin-1-yl]acetic acid.
| Compound Name | 2-[4-(2-adamantylamino)-5-chloro-6-oxopyridazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 59574350 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[4-(2-adamantylamino)-5-chloro-6-oxopyridazin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ncc(NC2C3CC4CC(C3)CC2C4)c(Cl)c1=O |
| InChI | InChI=1S/C16H20ClN3O3/c17-14-12(6-18-20(16(14)23)7-13(21)22)19-15-10-2-8-1-9(4-10)5-11(15)3-8/h6,8-11,15,19H,1-5,7H2,(H,21,22) |
| InChIKey | VYHNAHLCWVHMCR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |