C19H30Cl2N3O6RuS2- — CID 59574880
1,3-bis(methylsulfonyl)imidazolidin-2-ide;dichloro-[[2-[1-(diethylamino)-1-oxopropan-2-yl]oxyphenyl]methylidene]ruthenium (PubChem CID 59574880) has the molecular formula C19H30Cl2N3O6RuS2- and a molecular weight of 632.57 g/mol. Its IUPAC name is 1,3-bis(methylsulfonyl)imidazolidin-2-ide;dichloro-[[2-[1-(diethylamino)-1-oxopropan-2-yl]oxyphenyl]methylidene]ruthenium.
| Compound Name | 1,3-bis(methylsulfonyl)imidazolidin-2-ide;dichloro-[[2-[1-(diethylamino)-1-oxopropan-2-yl]oxyphenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 59574880 |
| Molecular Formula | C19H30Cl2N3O6RuS2- |
| Molecular Weight | 632.57 g/mol |
| Exact Mass | 632.00 |
| IUPAC Name | 1,3-bis(methylsulfonyl)imidazolidin-2-ide;dichloro-[[2-[1-(diethylamino)-1-oxopropan-2-yl]oxyphenyl]methylidene]ruthenium |
| SMILES | CCN(CC)C(=O)C(C)Oc1ccccc1C=[Ru](Cl)Cl.CS(=O)(=O)N1[CH-]N(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H19NO2.C5H11N2O4S2.2ClH.Ru/c1-5-15(6-2)14(16)12(4)17-13-10-8-7-9-11(13)3;1-12(8,9)6-3-4-7(5-6)13(2,10)11;;;/h3,7-10,12H,5-6H2,1-2,4H3;5H,3-4H2,1-2H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | OFNXHWQAQBNSLY-UHFFFAOYSA-L |
| XLogP | 2.04 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|