C17H34N2O — CID 59576120
N-(4,4,5,5-tetramethylhexyl)azepane-1-carboxamide (PubChem CID 59576120) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is N-(4,4,5,5-tetramethylhexyl)azepane-1-carboxamide.
| Compound Name | N-(4,4,5,5-tetramethylhexyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 59576120 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | N-(4,4,5,5-tetramethylhexyl)azepane-1-carboxamide |
| SMILES | CC(C)(C)C(C)(C)CCCNC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C17H34N2O/c1-16(2,3)17(4,5)11-10-12-18-15(20)19-13-8-6-7-9-14-19/h6-14H2,1-5H3,(H,18,20) |
| InChIKey | BVOVLGOIHVIMGF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|