C48H44N2O10 — CID 59582828
[2-cyano-3-isocyano-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate (PubChem CID 59582828) has the molecular formula C48H44N2O10 and a molecular weight of 808.88 g/mol. Its IUPAC name is [2-cyano-3-isocyano-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate.
| Compound Name | [2-cyano-3-isocyano-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59582828 |
| Molecular Formula | C48H44N2O10 |
| Molecular Weight | 808.88 g/mol |
| Exact Mass | 808.30 |
| IUPAC Name | [2-cyano-3-isocyano-4-[6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carbonyl]oxyphenyl] 6-(6-prop-2-enoyloxyhexoxy)naphthalene-2-carboxylate |
| SMILES | [C-]#[N+]c1c(OC(=O)c2ccc3cc(OCCCCCCOC(=O)C=C)ccc3c2)ccc(OC(=O)c2ccc3cc(OCCCCCCOC(=O)C=C)ccc3c2)c1C#N |
| InChI | InChI=1S/C48H44N2O10/c1-4-44(51)57-26-12-8-6-10-24-55-39-20-18-33-28-37(16-14-35(33)30-39)47(53)59-42-22-23-43(46(50-3)41(42)32-49)60-48(54)38-17-15-36-31-40(21-19-34(36)29-38)56-25-11-7-9-13-27-58-45(52)5-2/h4-5,14-23,28-31H,1-2,6-13,24-27H2 |
| InChIKey | ZNNYRQBMIYCYNM-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.88 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|