C18H28N6O5 — CID 59583552
7-[(2R,3R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-methoxy-4-(3-methylbutylamino)pyrrolo[2,3-d]pyrimidine-5-carboximidamide (PubChem CID 59583552) has the molecular formula C18H28N6O5 and a molecular weight of 408.46 g/mol. Its IUPAC name is 7-[(2R,3R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-methoxy-4-(3-methylbutylamino)pyrrolo[2,3-d]pyrimidine-5-carboximidamide.
| Compound Name | 7-[(2R,3R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-methoxy-4-(3-methylbutylamino)pyrrolo[2,3-d]pyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 59583552 |
| Molecular Formula | C18H28N6O5 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 7-[(2R,3R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-methoxy-4-(3-methylbutylamino)pyrrolo[2,3-d]pyrimidine-5-carboximidamide |
| SMILES | CO/N=C(\N)c1cn([C@@H]2OC(CO)C(O)[C@H]2O)c2ncnc(NCCC(C)C)c12 |
| InChI | InChI=1S/C18H28N6O5/c1-9(2)4-5-20-16-12-10(15(19)23-28-3)6-24(17(12)22-8-21-16)18-14(27)13(26)11(7-25)29-18/h6,8-9,11,13-14,18,25-27H,4-5,7H2,1-3H3,(H2,19,23)(H,20,21,22)/t11?,13?,14-,18-/m1/s1 |
| InChIKey | HSFMFEWLGGXCQD-DSYRPJGOSA-N |
| XLogP | -0.23 |
| TPSA | 160.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|