C17H27N6O8P — CID 59583606
[(4R,5R)-3,4-dihydroxy-5-[5-(N'-hydroxycarbamimidoyl)-4-(3-methylbutylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 59583606) has the molecular formula C17H27N6O8P and a molecular weight of 474.41 g/mol. Its IUPAC name is [(4R,5R)-3,4-dihydroxy-5-[5-(N'-hydroxycarbamimidoyl)-4-(3-methylbutylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(4R,5R)-3,4-dihydroxy-5-[5-(N'-hydroxycarbamimidoyl)-4-(3-methylbutylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59583606 |
| Molecular Formula | C17H27N6O8P |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [(4R,5R)-3,4-dihydroxy-5-[5-(N'-hydroxycarbamimidoyl)-4-(3-methylbutylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC(C)CCNc1ncnc2c1c(C(N)=NO)cn2[C@@H]1OC(COP(=O)(O)O)C(O)[C@H]1O |
| InChI | InChI=1S/C17H27N6O8P/c1-8(2)3-4-19-15-11-9(14(18)22-26)5-23(16(11)21-7-20-15)17-13(25)12(24)10(31-17)6-30-32(27,28)29/h5,7-8,10,12-13,17,24-26H,3-4,6H2,1-2H3,(H2,18,22)(H,19,20,21)(H2,27,28,29)/t10?,12?,13-,17-/m1/s1 |
| InChIKey | PFVYSEBSRHADJY-MXUAARBISA-N |
| XLogP | -0.29 |
| TPSA | 217.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|