C15H27N3O6 — CID 59611914
2-[[(2S)-2-(2-methylpropanoylamino)-5-(propan-2-yloxycarbonylamino)pentanoyl]amino]acetic acid (PubChem CID 59611914) has the molecular formula C15H27N3O6 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[[(2S)-2-(2-methylpropanoylamino)-5-(propan-2-yloxycarbonylamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-(2-methylpropanoylamino)-5-(propan-2-yloxycarbonylamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 59611914 |
| Molecular Formula | C15H27N3O6 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-[[(2S)-2-(2-methylpropanoylamino)-5-(propan-2-yloxycarbonylamino)pentanoyl]amino]acetic acid |
| SMILES | CC(C)OC(=O)NCCC[C@H](NC(=O)C(C)C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C15H27N3O6/c1-9(2)13(21)18-11(14(22)17-8-12(19)20)6-5-7-16-15(23)24-10(3)4/h9-11H,5-8H2,1-4H3,(H,16,23)(H,17,22)(H,18,21)(H,19,20)/t11-/m0/s1 |
| InChIKey | XQHUXAQMKDBOPP-NSHDSACASA-N |
| XLogP | 0.24 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|