C30H35NO3 — CID 59617317
oxolan-2-ylmethyl 4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzoate (PubChem CID 59617317) has the molecular formula C30H35NO3 and a molecular weight of 457.61 g/mol. Its IUPAC name is oxolan-2-ylmethyl 4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzoate.
| Compound Name | oxolan-2-ylmethyl 4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzoate |
|---|---|
| PubChem CID | 59617317 |
| Molecular Formula | C30H35NO3 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | oxolan-2-ylmethyl 4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclohexyl]benzoate |
| SMILES | C[C@@H](NC1CCCC(c2ccc(C(=O)OCC3CCCO3)cc2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H35NO3/c1-21(28-13-5-8-23-7-2-3-12-29(23)28)31-26-10-4-9-25(19-26)22-14-16-24(17-15-22)30(32)34-20-27-11-6-18-33-27/h2-3,5,7-8,12-17,21,25-27,31H,4,6,9-11,18-20H2,1H3/t21-,25?,26?,27?/m1/s1 |
| InChIKey | TXUPGXCSYDGTKS-QRJDWVPMSA-N |
| XLogP | 6.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |