C22H22FNO2S — CID 59621361
2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-methyl-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-1-phenylethanone (PubChem CID 59621361) has the molecular formula C22H22FNO2S and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-methyl-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-methyl-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 59621361 |
| Molecular Formula | C22H22FNO2S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-methyl-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-1-phenylethanone |
| SMILES | C[C@H]1OCC[C@]2(c3ccccc3F)N=C(CC(=O)c3ccccc3)SC[C@H]12 |
| InChI | InChI=1S/C22H22FNO2S/c1-15-18-14-27-21(13-20(25)16-7-3-2-4-8-16)24-22(18,11-12-26-15)17-9-5-6-10-19(17)23/h2-10,15,18H,11-14H2,1H3/t15-,18-,22-/m1/s1 |
| InChIKey | GAMAKEARFIQTIJ-YBOAYWMSSA-N |
| XLogP | 4.86 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |