C17H18N2 — CID 59621836
3-(2,6-dimethylphenyl)-2-phenyl-1,2-dihydroimidazole (PubChem CID 59621836) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-2-phenyl-1,2-dihydroimidazole.
| Compound Name | 3-(2,6-dimethylphenyl)-2-phenyl-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 59621836 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-2-phenyl-1,2-dihydroimidazole |
| SMILES | Cc1cccc(C)c1N1C=CNC1c1ccccc1 |
| InChI | InChI=1S/C17H18N2/c1-13-7-6-8-14(2)16(13)19-12-11-18-17(19)15-9-4-3-5-10-15/h3-12,17-18H,1-2H3 |
| InChIKey | GVVZWLSMMDWSDD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |