C10H11FN2 — CID 144782339
2-fluoro-3-(2-methylphenyl)-1,2-dihydroimidazole (PubChem CID 144782339) has the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. Its IUPAC name is 2-fluoro-3-(2-methylphenyl)-1,2-dihydroimidazole.
| Compound Name | 2-fluoro-3-(2-methylphenyl)-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 144782339 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-fluoro-3-(2-methylphenyl)-1,2-dihydroimidazole |
| SMILES | Cc1ccccc1N1C=CNC1F |
| InChI | InChI=1S/C10H11FN2/c1-8-4-2-3-5-9(8)13-7-6-12-10(13)11/h2-7,10,12H,1H3 |
| InChIKey | HQWMSIKJFXCWJF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|