C28H24IrN- — CID 59621880
6-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]-5-methyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium (PubChem CID 59621880) has the molecular formula C28H24IrN- and a molecular weight of 566.72 g/mol. Its IUPAC name is 6-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]-5-methyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium.
| Compound Name | 6-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]-5-methyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium |
|---|---|
| PubChem CID | 59621880 |
| Molecular Formula | C28H24IrN- |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 6-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]-5-methyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium |
| SMILES | Cc1c(-c2[c-]ccc(-c3ccc(C(C)(C)C)cc3)c2)nc2cccc3c2c1C=C3.[Ir] |
| InChI | InChI=1S/C28H24N.Ir/c1-18-24-16-13-20-7-6-10-25(26(20)24)29-27(18)22-9-5-8-21(17-22)19-11-14-23(15-12-19)28(2,3)4;/h5-8,10-17H,1-4H3;/q-1; |
| InChIKey | IDMIKZMBLIHTCR-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|