C29H26IrN- — CID 59622037
6-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]-5,11-dimethyl-7-azatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaene;iridium (PubChem CID 59622037) has the molecular formula C29H26IrN- and a molecular weight of 580.75 g/mol. Its IUPAC name is 6-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]-5,11-dimethyl-7-azatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaene;iridium.
| Compound Name | 6-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]-5,11-dimethyl-7-azatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaene;iridium |
|---|---|
| PubChem CID | 59622037 |
| Molecular Formula | C29H26IrN- |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | 6-[3-(4-tert-butylphenyl)benzene-6-id-1-yl]-5,11-dimethyl-7-azatricyclo[6.3.1.04,12]dodeca-1(11),2,4,6,8(12),9-hexaene;iridium |
| SMILES | Cc1ccc2nc(-c3[c-]ccc(-c4ccc(C(C)(C)C)cc4)c3)c(C)c3c2c1C=C3.[Ir] |
| InChI | InChI=1S/C29H26N.Ir/c1-18-9-16-26-27-24(18)14-15-25(27)19(2)28(30-26)22-8-6-7-21(17-22)20-10-12-23(13-11-20)29(3,4)5;/h6-7,9-17H,1-5H3;/q-1; |
| InChIKey | SLOVBSLPSOIEKZ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|