C4F8NO2S2- — CID 59637732
4,4,5,5,6,6,7,7-octafluoro-1λ4,3λ4-dithia-2-azanidacycloheptane 1,3-dioxide (PubChem CID 59637732) has the molecular formula C4F8NO2S2- and a molecular weight of 310.17 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7-octafluoro-1λ4,3λ4-dithia-2-azanidacycloheptane 1,3-dioxide.
| Compound Name | 4,4,5,5,6,6,7,7-octafluoro-1λ4,3λ4-dithia-2-azanidacycloheptane 1,3-dioxide |
|---|---|
| PubChem CID | 59637732 |
| Molecular Formula | C4F8NO2S2- |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | 4,4,5,5,6,6,7,7-octafluoro-1λ4,3λ4-dithia-2-azanidacycloheptane 1,3-dioxide |
| SMILES | O=S1[N-]S(=O)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C4F8NO2S2/c5-1(6)2(7,8)4(11,12)17(15)13-16(14)3(1,9)10/q-1 |
| InChIKey | FLUSGAXEAUTXSN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|