C4F8OS — CID 87925499
2,2,3,3,4,4,5,5-octafluorothiolane 1-oxide (PubChem CID 87925499) has the molecular formula C4F8OS and a molecular weight of 248.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluorothiolane 1-oxide.
| Compound Name | 2,2,3,3,4,4,5,5-octafluorothiolane 1-oxide |
|---|---|
| PubChem CID | 87925499 |
| Molecular Formula | C4F8OS |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluorothiolane 1-oxide |
| SMILES | O=S1C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C4F8OS/c5-1(6)2(7,8)4(11,12)14(13)3(1,9)10 |
| InChIKey | NJPCOHMYRIIJDU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|