C7F14OS — CID 87925261
2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorothiocane 1-oxide (PubChem CID 87925261) has the molecular formula C7F14OS and a molecular weight of 398.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorothiocane 1-oxide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorothiocane 1-oxide |
|---|---|
| PubChem CID | 87925261 |
| Molecular Formula | C7F14OS |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 397.94 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorothiocane 1-oxide |
| SMILES | O=S1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7F14OS/c8-1(9)2(10,11)4(14,15)6(18,19)23(22)7(20,21)5(16,17)3(1,12)13 |
| InChIKey | JAWCSQVFGLWKQY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|