C14H16FO3Si — CID 59638513
CID 59638513 (PubChem CID 59638513) has the molecular formula C14H16FO3Si and a molecular weight of 279.36 g/mol.
| Compound Name | CID 59638513 |
|---|---|
| PubChem CID | 59638513 |
| Molecular Formula | C14H16FO3Si |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | — |
| SMILES | FC1C[C@@]2(CO[Si])OC[C@H]1[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C14H16FO3Si/c15-12-6-14(9-18-19)13(11(12)8-17-14)16-7-10-4-2-1-3-5-10/h1-5,11-13H,6-9H2/t11-,12?,13-,14+/m1/s1 |
| InChIKey | WQMSYYNTVWJUGB-RLAWYHOSSA-N |
| XLogP | 1.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|