C11H21N3O6S2 — CID 59640677
(2S)-3-[[methanesulfonamido(methylsulfanyl)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 59640677) has the molecular formula C11H21N3O6S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2S)-3-[[methanesulfonamido(methylsulfanyl)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[[methanesulfonamido(methylsulfanyl)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 59640677 |
| Molecular Formula | C11H21N3O6S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (2S)-3-[[methanesulfonamido(methylsulfanyl)methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CS/C(=N\C[C@H](NC(=O)OC(C)(C)C)C(=O)O)NS(C)(=O)=O |
| InChI | InChI=1S/C11H21N3O6S2/c1-11(2,3)20-10(17)13-7(8(15)16)6-12-9(21-4)14-22(5,18)19/h7H,6H2,1-5H3,(H,12,14)(H,13,17)(H,15,16)/t7-/m0/s1 |
| InChIKey | WCZAWZLTSUTQLH-ZETCQYMHSA-N |
| XLogP | 0.23 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|